| Product Name | methyl 3-amino-4-cyano-5-(dimethylamino)thiophene-2-carboxylate |
| CAS No. | 175202-32-1 |
| InChI | InChI=1/C9H11N3O2S/c1-12(2)8-5(4-10)6(11)7(15-8)9(13)14-3/h11H2,1-3H3 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.2675 |
| Density | 1.33g/cm3 |
| Melting point | 240℃ |
| Boiling point | 445.6°C at 760 mmHg |
| Flash point | 223.3°C |
| Refractive index | 1.595 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175202-32-1 methyl 3-amino-4-cyano-5-(dimethylamino)thiophene-2-carboxylate
service@apichina.com