| Product Name | Methyl 3,5-difluorobenzoate |
| CAS No. | 216393-55-4 |
| Synonyms | 3,5-Difluorobenzoic acid methyl ester |
| InChI | InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.1288 |
| Density | 1.268g/cm3 |
| Boiling point | 202.7°C at 760 mmHg |
| Flash point | 74.6°C |
| Refractive index | 1.472 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
216393-55-4 methyl 3,5-difluorobenzoate
service@apichina.com