| Product Name | Methyl 3,5-dibromobenzoate |
| CAS No. | 51329-15-8 |
| Synonyms | 3,5-Dibromobenzoic acid methyl ester; 3,5-DIBROMOMETHYLBENZOATE; RARECHEM AL BF 0770 |
| InChI | InChI=1/C8H6Br2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | 293.94 |
| Density | 1.84g/cm3 |
| Melting point | 61-64℃ |
| Boiling point | 294.2°C at 760 mmHg |
| Flash point | 131.8°C |
| Refractive index | 1.583 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
51329-15-8 methyl 3,5-dibromobenzoate
service@apichina.com