| Product Name | methyl 3,5-dibromo-4-methylbenzoate |
| CAS No. | 74896-66-5 |
| Synonyms | 3,5-Dibromo-4-methylbenzoic acid methyl ester; 3,5-Dibromo-p-toluic acid methyl ester (COOCH3=1) |
| InChI | InChI=1/C9H8Br2O2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4H,1-2H3 |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | 307.9666 |
| Density | 1.75g/cm3 |
| Boiling point | 314°C at 760 mmHg |
| Flash point | 143.7°C |
| Refractive index | 1.575 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
74896-66-5 methyl 3,5-dibromo-4-methylbenzoate
service@apichina.com