| Product Name | Methyl 3,5-dibromo-2,4-dimethoxy-6-methylbenzoate |
| CAS No. | 150965-73-4 |
| Synonyms | 3,5-Dibromo-2,4-dimethoxy-6-methylbenzoic acid methyl ester |
| InChI | InChI=1/C11H12Br2O4/c1-5-6(11(14)17-4)9(15-2)8(13)10(16-3)7(5)12/h1-4H3 |
| Molecular Formula | C11H12Br2O4 |
| Molecular Weight | 368.0186 |
| Density | 1.643g/cm3 |
| Boiling point | 398°C at 760 mmHg |
| Flash point | 194.5°C |
| Refractive index | 1.552 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
150965-73-4 methyl 3,5-dibromo-2,4-dimethoxy-6-methylbenzoate
service@apichina.com
- Next:82219-81-6 cefuzoname sodium
- Previous:82219-78-1 cefuzonam