| Product Name | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
| CAS No. | 715-33-3 |
| Synonyms | 3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
| InChI | InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
| Molecular Formula | C9H8Br2O4 |
| Molecular Weight | 339.9654 |
| Density | 1.967g/cm3 |
| Boiling point | 307.4°C at 760 mmHg |
| Flash point | 139.7°C |
| Refractive index | 1.636 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
715-33-3 methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate
service@apichina.com