| Product Name | Methyl 3,4-dihydroxybenzoate |
| CAS No. | 2150-43-8 |
| Synonyms | 3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
| InChI | InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.1467 |
| Density | 1.354g/cm3 |
| Boiling point | 351.5°C at 760 mmHg |
| Flash point | 148.5°C |
| Refractive index | 1.587 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2150-43-8 methyl 3,4-dihydroxybenzoate
service@apichina.com