| Product Name | Methyl 3-(3-pyridyl)propionate |
| CAS No. | 84199-98-4 |
| Synonyms | 3-(3-Pyridyl)propionic acid methyl ester; methyl 3-pyridin-3-ylpropanoate |
| InChI | InChI=1/C9H11NO2/c1-12-9(11)5-4-8-3-2-6-10-7-8/h2-3,6-7H,4-5H2,1H3 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.086g/cm3 |
| Boiling point | 253.3°C at 760 mmHg |
| Flash point | 107°C |
| Refractive index | 1.503 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
84199-98-4 methyl 3-(3-pyridyl)propionate
service@apichina.com