| Product Name | Methyl 3-(2-hydroxyphenyl)propionate |
| CAS No. | 20349-89-7 |
| Synonyms | Methyl 3-(2-hydroxyphenyl)propanoate |
| InChI | InChI=1/C10H12O3/c1-13-10(12)7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.146g/cm3 |
| Melting point | 40℃ |
| Boiling point | 280.2°C at 760 mmHg |
| Flash point | 116.6°C |
| Refractive index | 1.532 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
20349-89-7 methyl 3-(2-hydroxyphenyl)propionate
service@apichina.com