| Product Name | methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate |
| CAS No. | 227958-47-6 |
| Synonyms | methyl 3-[(bromoacetyl)amino]thiophene-2-carboxylate |
| InChI | InChI=1/C8H8BrNO3S/c1-13-8(12)7-5(2-3-14-7)10-6(11)4-9/h2-3H,4H2,1H3,(H,10,11) |
| Molecular Formula | C8H8BrNO3S |
| Molecular Weight | 278.123 |
| Density | 1.705g/cm3 |
| Melting point | 89℃ |
| Boiling point | 442.1°C at 760 mmHg |
| Flash point | 221.1°C |
| Refractive index | 1.635 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
227958-47-6 methyl 3-[(2-bromoacetyl)amino]thiophene-2-carboxylate
service@apichina.com