| Product Name | methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate |
| CAS No. | 4402-83-9 |
| Synonyms | methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChI | InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.1108 |
| Density | 1.37g/cm3 |
| Melting point | 115℃ |
| Boiling point | 382.4°C at 760 mmHg |
| Flash point | 185.1°C |
| Refractive index | 1.561 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4402-83-9 methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
service@apichina.com