| Product Name | Methyl 3-(1-pyrrolo)thiophene-2-carboxylate |
| CAS No. | 74772-16-0 |
| Synonyms | 3-(1-Pyrrolo)thiophene-2-carboxylic acid methyl eser; methyl 3-(1H-pyrrol-1-yl)thiophene-2-carboxylate |
| InChI | InChI=1/C10H9NO2S/c1-13-10(12)9-8(4-7-14-9)11-5-2-3-6-11/h2-7H,1H3 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.249 |
| Density | 1.25g/cm3 |
| Boiling point | 345.7°C at 760 mmHg |
| Flash point | 162.9°C |
| Refractive index | 1.613 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
74772-16-0 methyl 3-(1-pyrrolo)thiophene-2-carboxylate
service@apichina.com