| Product Name | Methyl 2-nonynoate |
| CAS No. | 111-80-8 |
| Synonyms | 2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
| InChI | InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.2328 |
| Density | 0.932g/cm3 |
| Boiling point | 233.1°C at 760 mmHg |
| Flash point | 100.6°C |
| Refractive index | 1.446 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
111-80-8 methyl 2-nonynoate
service@apichina.com