| Product Name | methyl 2-naphthoate |
| CAS No. | 2459-25-8 |
| Synonyms | 2-Naphthoic acid methyl ester; methyl naphthalene-2-carboxylate |
| InChI | InChI=1/C12H10O2/c1-14-12(13)11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.2066 |
| Density | 1.153g/cm3 |
| Melting point | 75-77℃ |
| Boiling point | 290°C at 760 mmHg |
| Flash point | 145.8°C |
| Refractive index | 1.608 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
2459-25-8 methyl 2-naphthoate
service@apichina.com