| Product Name | Methyl 2-(methylthio)butyrate |
| CAS No. | 51534-66-8 |
| Synonyms | 2-(Methylthio)butyric acid methyl ester; methyl 2-(methylsulfanyl)butanoate; methyl (2S)-2-(methylsulfanyl)butanoate; methyl (2R)-2-(methylsulfanyl)butanoate |
| InChI | InChI=1/C6H12O2S/c1-4-5(9-3)6(7)8-2/h5H,4H2,1-3H3/t5-/m1/s1 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.2233 |
| Density | 1.019g/cm3 |
| Boiling point | 176.1°C at 760 mmHg |
| Flash point | 64.4°C |
| Refractive index | 1.456 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
51534-66-8 methyl 2-(methylthio)butyrate
service@apichina.com