| Product Name | Methyl 2-methoxypropionate |
| CAS No. | 17639-76-8 |
| Synonyms | 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| InChI | InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.1311 |
| Density | 0.973g/cm3 |
| Boiling point | 136.2°C at 760 mmHg |
| Flash point | 40.6°C |
| Refractive index | 1.389 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17639-76-8 methyl 2-methoxypropionate
service@apichina.com