| Product Name | Methyl 2-isothiocyanatoacetate |
| CAS No. | 21055-37-8 |
| Synonyms | 2-Isothiocyanatoacetic acid methyl ester; thyl 2-isothiocyanatoacetate; methyl N-(thioxomethylidene)glycinate |
| InChI | InChI=1/C4H5NO2S/c1-7-4(6)2-5-3-8/h2H2,1H3 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.153 |
| Density | 1.16g/cm3 |
| Boiling point | 193.9°C at 760 mmHg |
| Flash point | 71.1°C |
| Refractive index | 1.503 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
21055-37-8 methyl 2-isothiocyanatoacetate
service@apichina.com