| Product Name | methyl 2-isocyanatobenzoate |
| CAS No. | 1793-07-3 |
| Synonyms | 2-(Carbomethoxy)phenyl isocyanate~Methyl 2-isocyanatobenzoate |
| InChI | InChI=1/C9H7NO3/c1-13-9(12)7-4-2-3-5-8(7)10-6-11/h2-5H,1H3 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.1568 |
| Density | 1.15g/cm3 |
| Melting point | 45-49℃ |
| Boiling point | 267.1°C at 760 mmHg |
| Flash point | 124.8°C |
| Refractive index | 1.528 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1793-07-3 methyl 2-isocyanatobenzoate
service@apichina.com