| Product Name | Methyl 2-hexynoate |
| CAS No. | 18937-79-6 |
| Synonyms | 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
| InChI | InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.1531 |
| Density | 0.963g/cm3 |
| Boiling point | 184.4°C at 760 mmHg |
| Flash point | 65.4°C |
| Refractive index | 1.436 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18937-79-6 methyl 2-hexynoate
service@apichina.com