| Product Name | methyl 2-[(cyanomethyl)thio]benzoate |
| CAS No. | 57601-89-5 |
| Synonyms | methyl 2-[(cyanomethyl)sulfanyl]benzoate |
| InChI | InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.249 |
| Density | 1.24g/cm3 |
| Melting point | 121℃ |
| Boiling point | 338.6°C at 760 mmHg |
| Flash point | 158.6°C |
| Refractive index | 1.574 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
service@apichina.com