| Product Name | methyl 2-cyanobenzoate |
| CAS No. | 6587-24-2 |
| InChI | InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.1574 |
| Density | 1.18g/cm3 |
| Melting point | 47℃ |
| Boiling point | 295.8°C at 760 mmHg |
| Flash point | 136.2°C |
| Refractive index | 1.535 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6587-24-2 methyl 2-cyanobenzoate
service@apichina.com