| Product Name | methyl 2-cyano-2-(2-nitrophenyl)acetate |
| CAS No. | 113772-13-7 |
| Synonyms | methyl cyano(2-nitrophenyl)acetate |
| InChI | InChI=1/C10H8N2O4/c1-16-10(13)8(6-11)7-4-2-3-5-9(7)12(14)15/h2-5,8H,1H3 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.1815 |
| Density | 1.336g/cm3 |
| Melting point | 58℃ |
| Boiling point | 393.2°C at 760 mmHg |
| Flash point | 191.6°C |
| Refractive index | 1.56 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
113772-13-7 methyl 2-cyano-2-(2-nitrophenyl)acetate
service@apichina.com