| Product Name | Methyl 2-chlorobenzoate |
| CAS No. | 610-96-8 |
| Synonyms | Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
| InChI | InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.593 |
| Density | 1.224g/cm3 |
| Boiling point | 225.4°C at 760 mmHg |
| Flash point | 101.7°C |
| Refractive index | 1.528 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
610-96-8 methyl 2-chlorobenzoate
service@apichina.com