| Product Name | Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
| CAS No. | 89793-11-3 |
| Synonyms | Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
| InChI | InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.5957 |
| Density | 1.314g/cm3 |
| Melting point | 107℃ |
| Boiling point | 306.5°C at 760 mmHg |
| Flash point | 139.2°C |
| Refractive index | 1.53 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
89793-11-3 methyl-2-chloro-6-methylpyrimidine-4-carboxylate
service@apichina.com