| Product Name | Methyl 2-chloro-4-nitrobenzoate |
| CAS No. | 13324-11-3 |
| Synonyms | 2-Chloro-4-nitrobenzoic acid methyl ester |
| InChI | InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3 |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.5905 |
| Density | 1.426g/cm3 |
| Melting point | 74-75℃ |
| Boiling point | 324.8°C at 760 mmHg |
| Flash point | 150.2°C |
| Refractive index | 1.568 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13324-11-3 methyl 2-chloro-4-nitrobenzoate
service@apichina.com