| Product Name | Methyl 2-bromooctanoate |
| CAS No. | 5445-22-7 |
| Synonyms | 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
| InChI | InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
| Molecular Formula | C9H17BrO2 |
| Molecular Weight | 237.1341 |
| Density | 1.221g/cm3 |
| Boiling point | 227.7°C at 760 mmHg |
| Flash point | 101.9°C |
| Refractive index | 1.46 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5445-22-7 methyl 2-bromooctanoate
service@apichina.com