| Product Name | Methyl 2-bromo-5-methoxybenzoate |
| CAS No. | 35450-36-3 |
| Synonyms | 2-Bromo-5-methoxybenzoic acid methyl ester |
| InChI | InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 |
| Density | 1.462g/cm3 |
| Boiling point | 291.9°C at 760 mmHg |
| Flash point | 130.4°C |
| Refractive index | 1.537 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
35450-36-3 methyl 2-bromo-5-methoxybenzoate
service@apichina.com