| Product Name | Methyl 2-amino-5-chloro-3-iodobenzoate |
| CAS No. | 289039-84-5 |
| Synonyms | 2-Amino-5-chloro-3-iodobenzoic acid methyl ester |
| InChI | InChI=1/C8H7ClINO2/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3H,11H2,1H3 |
| Molecular Formula | C8H7ClINO2 |
| Molecular Weight | 311.5042 |
| Density | 1.903g/cm3 |
| Boiling point | 360.6°C at 760 mmHg |
| Flash point | 171.9°C |
| Refractive index | 1.655 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
289039-84-5 methyl 2-amino-5-chloro-3-iodobenzoate
service@apichina.com