| Product Name | methyl 2,6-dichloro-5-fluoronicotinate |
| CAS No. | 189281-66-1 |
| Synonyms | methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate |
| InChI | InChI=1/C7H4Cl2FNO2/c1-13-7(12)3-2-4(10)6(9)11-5(3)8/h2H,1H3 |
| Molecular Formula | C7H4Cl2FNO2 |
| Molecular Weight | 224.0166 |
| Density | 1.506g/cm3 |
| Boiling point | 269.9°C at 760 mmHg |
| Flash point | 117.1°C |
| Refractive index | 1.529 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
189281-66-1 methyl 2,6-dichloro-5-fluoronicotinate
service@apichina.com