| Product Name | methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| CAS No. | 69687-80-5 |
| Synonyms | Methyl 2,5-dimethylpyrrole-3-carboxylate |
| InChI | InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.1784 |
| Density | 1.108g/cm3 |
| Melting point | 115℃ |
| Boiling point | 294.3°C at 760 mmHg |
| Flash point | 131.8°C |
| Refractive index | 1.521 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
69687-80-5 methyl 2,5-dimethyl-1h-pyrrole-3-carboxylate
service@apichina.com