| Product Name | Methyl 2,5-dichlorothiophene-3-carboxylate |
| CAS No. | 145129-54-0 |
| Synonyms | 2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
| InChI | InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
| Molecular Formula | C6H4Cl2O2S |
| Molecular Weight | 211.0658 |
| Density | 1.5g/cm3 |
| Boiling point | 257.3°C at 760 mmHg |
| Flash point | 109.4°C |
| Refractive index | 1.57 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
145129-54-0 methyl 2,5-dichlorothiophene-3-carboxylate
service@apichina.com