| Product Name | Methyl 2,4,6-trihydroxybenzoate |
| CAS No. | 3147-39-5 |
| Synonyms | 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
| InChI | InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.1461 |
| Density | 1.501g/cm3 |
| Melting point | 174-176℃ |
| Boiling point | 359.5°C at 760 mmHg |
| Flash point | 150.3°C |
| Refractive index | 1.63 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3147-39-5 methyl 2,4,6-trihydroxybenzoate
service@apichina.com