| Product Name | Methyl 2,4,5-trichlorophenyl sulfide |
| CAS No. | 4163-78-4 |
| Synonyms | methyl 2,4,5-trichlorophenyl sulphide; Thichlorothioanisole; 2,4,5-Trichlorothioanisole; 1,2,4-trichloro-5-(methylsulfanyl)benzene |
| InChI | InChI=1/C7H5Cl3S/c1-11-7-3-5(9)4(8)2-6(7)10/h2-3H,1H3 |
| Molecular Formula | C7H5Cl3S |
| Molecular Weight | 227.5386 |
| Density | 1.47g/cm3 |
| Melting point | 51-55℃ |
| Boiling point | 272.6°C at 760 mmHg |
| Flash point | 115.9°C |
| Refractive index | 1.617 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4163-78-4 methyl 2,4,5-trichlorophenyl sulfide
service@apichina.com