| Product Name | methyl 2-[(3-amino-3-thioxopropyl)thio]acetate |
| CAS No. | 175202-95-6 |
| Synonyms | methyl [(3-amino-3-thioxopropyl)sulfanyl]acetate |
| InChI | InChI=1/C6H11NO2S2/c1-9-6(8)4-11-3-2-5(7)10/h2-4H2,1H3,(H2,7,10) |
| Molecular Formula | C6H11NO2S2 |
| Molecular Weight | 193.287 |
| Density | 1.257g/cm3 |
| Melting point | 74℃ |
| Boiling point | 308°C at 760 mmHg |
| Flash point | 140.1°C |
| Refractive index | 1.57 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175202-95-6 methyl 2-[(3-amino-3-thioxopropyl)thio]acetate
service@apichina.com