| Product Name | methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate |
| CAS No. | 82140-55-4 |
| Synonyms | methyl (2Z)-2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate; methyl 2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate |
| InChI | InChI=1/C12H12Cl2N2O3/c1-6(15-2)10(12(18)19-3)11(17)7-4-8(13)16-9(14)5-7/h4-5,15H,1-3H3 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.1413 |
| Density | 1.34g/cm3 |
| Melting point | 112℃ |
| Boiling point | 462.9°C at 760 mmHg |
| Flash point | 233.8°C |
| Refractive index | 1.553 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
service@apichina.com
- Next:150756-35-7 efletirizine
- Previous:82140-22-5 etolotifen