| Sales Email | Service@apichina.com |
| CAS No. | 14065-32-8 |
| Product Name | methyl 10-chloro-10-oxodecanoate |
| Synonyms | Methyl sebacoyl chloride; Sebacinic acid monomethylester monochloride |
| InChI | InChI=1/C11H19ClO3/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3 |
| Molecular Formula | C11H19ClO3 |
| Molecular Weight | 234.7198 |
| Density | 1.056g/cm3 |
| Boiling point | 286.3°C at 760 mmHg |
| Flash point | 102.4°C |
| Refractive index | 1.449 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
