| Product Name | meso-tartaric acid hydrate |
| CAS No. | 147-73-9 |
| Synonyms | Mesotartaric acid monohydrate; Mesotartaricacid; Tartaric acid, meso, monohydrate; Mesotartaric acid; (2S)-2,3-dihydroxybutanedioic acid; (2R,3S)-2,3-dihydroxybutanedioic acid |
| InChI | InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2+ |
| Molecular Formula | C4H6O6 |
| Molecular Weight | 150.0868 |
| Density | 1.886g/cm3 |
| Melting point | 165-166℃ |
| Boiling point | 399.3°C at 760 mmHg |
| Flash point | 209.4°C |
| Refractive index | 1.585 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
147-73-9 meso-tartaric acid hydrate
service@apichina.com