| Product Name | Mesitylglyoxylic acid |
| CAS No. | 3112-46-7 |
| Synonyms | 2,4,6-Trimethylbenzoylformic acid; oxo(2,4,6-trimethylphenyl)acetic acid |
| InChI | InChI=1/C11H12O3/c1-6-4-7(2)9(8(3)5-6)10(12)11(13)14/h4-5H,1-3H3,(H,13,14) |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.2112 |
| Density | 1.169g/cm3 |
| Boiling point | 339.9°C at 760 mmHg |
| Flash point | 173.5°C |
| Refractive index | 1.549 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3112-46-7 mesitylglyoxylic acid
service@apichina.com