| Product Name | Mercaptopropionicacidethylester |
| CAS No. | 19788-49-9 |
| Synonyms | 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
| InChI | InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.1967 |
| Density | 1.04g/cm3 |
| Boiling point | 171.7°C at 760 mmHg |
| Flash point | 57.4°C |
| Refractive index | 1.452 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
19788-49-9 mercaptopropionicacidethylester
service@apichina.com