| Product Name | MCPB |
| CAS No. | 94-81-5 |
| Synonyms | 4-(4-Chloro-o-tolyloxy)butyric acid; 2,4-MCPB; 4-(4-Chloro-2-methylphenoxy)butyric acid; MCPB; 4-(2-Methyl-4-chlorophenoxy)butyric acid; 2-(4-chloro-2-methylphenoxy)butanoic acid |
| InChI | InChI=1/C11H13ClO3/c1-3-9(11(13)14)15-10-5-4-8(12)6-7(10)2/h4-6,9H,3H2,1-2H3,(H,13,14) |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.6721 |
| Density | 1.228g/cm3 |
| Boiling point | 345.1°C at 760 mmHg |
| Flash point | 162.5°C |
| Refractive index | 1.536 |
| Risk Codes | R22:Harmful if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
94-81-5 mcpb
service@apichina.com