| Product Name | Martius Yellow |
| CAS No. | 605-69-6 |
| Synonyms | C.I. 10315; Martius yellow; 2,4-Dinitro-1-naphthol; Acid Yellow 24; C.I. 10315~Martius Yellow; 2,4-dinitronaphthalen-1-ol; 2,4-dinitronaphthalen-1-olate |
| InChI | InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
| Molecular Formula | C10H5N2O5 |
| Molecular Weight | 233.1576 |
| Melting point | 130-133℃ |
| Boiling point | 407.9°C at 760 mmHg |
| Flash point | 179.9°C |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
605-69-6 martius yellow
service@apichina.com