| Product Name | Mandelic acid hydrazide |
| CAS No. | 2443-66-5 |
| Synonyms | Mandelhydrazine; Mandelic acid, hydrazide; 2-Hydroxy-2-phenylacetohydrazide; (2S)-2-hydroxy-2-phenylethanehydrazide; (2R)-2-hydroxy-2-phenylethanehydrazide |
| InChI | InChI=1/C8H10N2O2/c9-10-8(12)7(11)6-4-2-1-3-5-6/h1-5,7,11H,9H2,(H,10,12)/t7-/m1/s1 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.277g/cm3 |
| Boiling point | 420.9°C at 760 mmHg |
| Flash point | 208.3°C |
| Refractive index | 1.599 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2443-66-5 mandelic acid hydrazide
service@apichina.com