| Product Name | Malonic-d2 acid-d2 |
| CAS No. | 813-56-9 |
| Synonyms | Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| InChI | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| Molecular Formula | C3D4O4 |
| Molecular Weight | 108.0861 |
| Density | 1.605g/cm3 |
| Melting point | 130-132℃ |
| Boiling point | 386.8°C at 760 mmHg |
| Flash point | 201.9°C |
| Refractive index | 1.478 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
813-56-9 malonic-d2 acid-d2
service@apichina.com