| Product Name | maleic acid, ester with hydracrylonitrile |
| CAS No. | 14533-68-7 |
| Synonyms | 2-Butenedioic acid (2Z)-, 1-(2-cyanoethyl) ester; 2-Butenedioic acid (Z), mono(2-cyanoethyl) ester; Mono(2-cyanoethyl) maleate; 2-Butenedioic acid (2Z)-, mono(2-cyanoethyl) ester; 2-Butenedioic acid (Z)-, mono(2-cyanoethyl) ester; Maleic acid, ester with hydracrylonitrile; (2Z)-4-(2-cyanoethoxy)-4-oxobut-2-enoic acid |
| InChI | InChI=1/C7H7NO4/c8-4-1-5-12-7(11)3-2-6(9)10/h2-3H,1,5H2,(H,9,10)/b3-2- |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.1348 |
| Density | 1.309g/cm3 |
| Boiling point | 405.2°C at 760 mmHg |
| Flash point | 198.8°C |
| Refractive index | 1.496 |
14533-68-7 maleic acid, ester with hydracrylonitrile
service@apichina.com