| Product Name | (m-Tolyloxy)-acetic acid |
| CAS No. | 1643-15-8 |
| Synonyms | 3-Methylphenoxyacetic acid; (3-methylphenoxy)acetic acid; (3-methylphenoxy)acetate |
| InChI | InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| Molecular Formula | C9H9O3 |
| Molecular Weight | 165.1665 |
| Boiling point | 300°C at 760 mmHg |
| Flash point | 121.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1643-15-8 (m-tolyloxy)-acetic acid
service@apichina.com