| Product Name | m-Toluoyl and benzoyl peroxide |
| CAS No. | 1712-87-4 |
| Synonyms | Peroxide, bis(3-methylbenzoyl); Di-(2-methylbenzoyl)peroxide; Nyper MT; Nyper MT 80; m-Methylbenzoyl peroxide; m-Toluoyl peroxide; bis(3-methylphenyl)peroxyanhydride |
| InChI | InChI=1/C16H14O4/c1-11-5-3-7-13(9-11)15(17)19-20-16(18)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| Density | 1.198g/cm3 |
| Boiling point | 404.508°C at 760 mmHg |
| Flash point | 179.191°C |
| Refractive index | 1.573 |
1712-87-4 m-toluoyl and benzoyl peroxide
service@apichina.com