| Product Name | m-Toluic hydrazide |
| CAS No. | 13050-47-0 |
| Synonyms | m-Tolucid acid hydrazide; 3-methylbenzohydrazide |
| InChI | InChI=1/C8H10N2O/c1-6-3-2-4-7(5-6)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.1778 |
| Density | 1.127g/cm3 |
| Refractive index | 1.568 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13050-47-0 m-toluic hydrazide
service@apichina.com