| Product Name | lupinine |
| CAS No. | 486-70-4 |
| Synonyms | (-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
| InChI | InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.264 |
| Density | 1.04g/cm3 |
| Melting point | 68-69℃ |
| Boiling point | 270°C at 760 mmHg |
| Flash point | 99.1°C |
| Refractive index | 1.525 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
486-70-4 lupinine
service@apichina.com