| Product Name | Lithium acetylacetonate |
| CAS No. | 18115-70-3 |
| Synonyms | Lithium 2,4-pentanedionate; lithium (2Z)-4-oxopent-2-en-2-olate; 2,4-pentanedione, lithium salt (1:1); Lithium Acetylacetone; Lithium Acetylacetone |
| InChI | InChI=1/C5H8O2.Li/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1 |
| Molecular Formula | C5H8LiO2 |
| Molecular Weight | 107.0563 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R63:Possible risk of harm to the unborn child.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18115-70-3 lithium acetylacetonate
service@apichina.com