| Product Name | Levulinic acid semicarbazone |
| CAS No. | 89532-09-2 |
| Synonyms | 4-(2-carbamoylhydrazinylidene)pentanoic acid |
| InChI | InChI=1/C6H11N3O3/c1-4(2-3-5(10)11)8-9-6(7)12/h2-3H2,1H3,(H,10,11)(H3,7,9,12) |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.1698 |
| Density | 1.37g/cm3 |
| Refractive index | 1.555 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
89532-09-2 levulinic acid semicarbazone
service@apichina.com